Drugs present in MMsINC which are similar to the molecule MMscode: MMs02433503
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725958 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01725636 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01725834 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01725836 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01727507 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.72 |
MMs01727505 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.72 |
MMs01726761 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01726763 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01726765 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01726759 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.72 |
MMs01725766 | Oc1cc(cc(O)c1)C(O)CNCCCn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.70 |