Drugs present in MMsINC which are similar to the molecule MMscode: MMs02424697
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725508 | O(C(=O)C)CC(CCn1c2nc(ncc2nc1)N)COC(=O)C | 0.73 |
MMs01725628 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.72 |
MMs01726466 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.72 |
MMs01726464 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.72 |
MMs01726465 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.72 |
MMs01725956 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725954 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |