Drugs present in MMsINC which are similar to the molecule MMscode: MMs02422351
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.77 |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.77 |
MMs01725947 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.77 |
MMs01726922 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.77 |
MMs01725244 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.76 |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.76 |
MMs01724975 | Oc1c([N+](=O)[O-])cc(cc1O)C(=O)c1ccc(cc1)C | 0.74 |