Drugs present in MMsINC which are similar to the molecule MMscode: MMs02421927
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725766 | Oc1cc(cc(O)c1)C(O)CNCCCn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.78 |
MMs01725205 | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.74 |
MMs01725422 | O1CCCC1C(=O)N1CCN(CC1)c1nc(N)c2cc(OC)c(OC)cc2n1 | 0.74 |
MMs01725213 | Fc1ccc(cc1)Cn1c2c(nc1NC1CCN(CC1)CCc1ccc(OC)cc1)cccc2 | 0.72 |
MMs01725210 | O(C)c1cc2c(nc(nc2N)N2CCCN(CC2)C(=O)CCC)cc1OC | 0.71 |