Drugs present in MMsINC which are similar to the molecule MMscode: MMs02415758
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.83 |
MMs01726736![]() | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.77 |
MMs01725838![]() | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.76 |
MMs01725451![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.76 |
MMs01724776![]() | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.76 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.76 |
MMs01725753![]() | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.74 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.72 |
MMs01725084![]() | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.70 |