Drugs present in MMsINC which are similar to the molecule MMscode: MMs02415438
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.87 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.78 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.78 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.78 |
MMs01725451 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.77 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.76 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.73 |
MMs01725838 | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.73 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01726500 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01727061 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)C=CC2O | 0.70 |