Drugs present in MMsINC which are similar to the molecule MMscode: MMs02414620
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724995 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.75 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.75 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.75 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726873 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.72 |
MMs01724901 | O(C(=O)C1(CCN(CC1)C)c1ccccc1)CC | 0.70 |
MMs01726172 | O(C(=O)C1(CCCC1)c1ccccc1)CCOCCN(CC)CC | 0.70 |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.70 |
MMs01724957 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.70 |
MMs01725566 | O(CC(COC(=O)N)c1ccccc1)C(=O)N | 0.70 |