Drugs present in MMsINC which are similar to the molecule MMscode: MMs02409429
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725048 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.75 |
MMs01727224 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.75 |
MMs01726500 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.72 |
MMs01727061 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)C=CC2O | 0.71 |
MMs01727102 | O1C2C34C(C(N(CC3)CC=C)Cc3c4c1c(O)cc3)C=CC2O | 0.71 |
MMs01726665 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.70 |
MMs01726667 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.70 |
MMs01726620 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)CCC2O | 0.70 |