Drugs present in MMsINC which are similar to the molecule MMscode: MMs02407148
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727198 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.71 |
MMs01727200 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.71 |
MMs01727202 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.71 |
MMs01727204 | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.71 |