Drugs present in MMsINC which are similar to the molecule MMscode: MMs02405234
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725693 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.79 |
MMs01726921 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.79 |
MMs01726920 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.79 |
MMs01726919 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.79 |
MMs01726431 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.77 |
MMs01726428 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.77 |
MMs01726429 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.77 |
MMs01726430 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.77 |
MMs01726027 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.75 |
MMs01726025 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.75 |
MMs01726023 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.75 |
MMs01726021 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.75 |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |