Drugs present in MMsINC which are similar to the molecule MMscode: MMs02403342
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725453 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.79 |
MMs01725702 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.79 |
MMs01726898 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.79 |
MMs01727011 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.74 |
MMs01727012 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.74 |
MMs01727013 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.74 |
MMs01727014 | Ic1c(C(=O)NC2C(O)C(O)C(OC2O)CO)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.74 |