Drugs present in MMsINC which are similar to the molecule MMscode: MMs02398158
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727031 | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727033 | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727035 | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727037 | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |