Drugs present in MMsINC which are similar to the molecule MMscode: MMs02397557
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727245 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.74 |
MMs01727247 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.74 |
MMs01727249 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.74 |
MMs01727251 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.74 |
MMs01726638 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01726640 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01726636 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |