Drugs present in MMsINC which are similar to the molecule MMscode: MMs02395121
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726021![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.73 |
MMs01726023![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.73 |
MMs01726025![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.73 |
MMs01726027![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.73 |
MMs01727637![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.71 |
MMs01727639![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.71 |
MMs01727641![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.71 |
MMs01727643![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.71 |