Drugs present in MMsINC which are similar to the molecule MMscode: MMs02393785
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727031![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.74 |
MMs01727033![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.74 |
MMs01727035![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.74 |
MMs01727037![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.74 |
MMs01727116![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.73 |
MMs01727118![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.73 |
MMs01727120![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.73 |
MMs01727122![]() | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.73 |