Drugs present in MMsINC which are similar to the molecule MMscode: MMs02388468
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725602![]() | P(O)(O)(=O)C(P(O)(O)=O)(O)Cc1cccnc1 | 0.78 |
MMs01724962![]() | Oc1nc(C)c(cc1C#N)-c1ccncc1 | 0.73 |
MMs01724839![]() | Oc1ncc(cc1N)-c1ccncc1 | 0.72 |
MMs01724886![]() | S=C(N)c1cc(ncc1)CC | 0.71 |
MMs01724927![]() | O(C(=O)N(C)C)c1ccc[n+](c1)C | 0.70 |
MMs01725860![]() | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.70 |