Drugs present in MMsINC which are similar to the molecule MMscode: MMs02381009
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725418 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.80 |
MMs01725203 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.80 |
MMs01727009 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01725678 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01727005 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01727007 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01726118 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.70 |
MMs01726112 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.70 |
MMs01726114 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.70 |
MMs01726116 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.70 |