Drugs present in MMsINC which are similar to the molecule MMscode: MMs02380541
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.82 |
MMs01727457![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727458![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727459![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727460![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01726519![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.71 |
MMs01725392![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.71 |
MMs01726518![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.71 |
MMs01724743![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.71 |