Drugs present in MMsINC which are similar to the molecule MMscode: MMs02380053
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.84 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.84 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.79 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.77 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.77 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.77 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.76 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.72 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.70 |