Drugs present in MMsINC which are similar to the molecule MMscode: MMs02373810
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.77 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.77 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.75 |
MMs01725603 | ClCC\C(=C(/c1ccc(OCCN(C)C)cc1)\c1ccccc1)\c1ccccc1 | 0.75 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.70 |