Drugs present in MMsINC which are similar to the molecule MMscode: MMs02365109
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725013![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.80 |
MMs01725694![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.80 |
MMs01725677![]() | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.78 |
MMs01725611![]() | O=C1NC(=Nc2ncc(nc12)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.72 |
MMs01725232![]() | S(=O)(=O)(Nc1cc2cc([nH]c2cc1)C(=O)N1CCN(CC1)c1ncccc1NC(C)C)C | 0.72 |