Drugs present in MMsINC which are similar to the molecule MMscode: MMs02361054
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.80 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.80 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.77 |
MMs01724898 | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.75 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.75 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.75 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.72 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01725027 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01724929 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01726926 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |