Drugs present in MMsINC which are similar to the molecule MMscode: MMs02358077
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.94 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.80 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.80 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.73 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.72 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |
MMs01726880 | Ic1c(CCC(O)=O)c(I)cc(I)c1\N=C\N(C)C | 0.70 |