Drugs present in MMsINC which are similar to the molecule MMscode: MMs02349987
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725753![]() | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.75 |
MMs01725838![]() | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.75 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.74 |
MMs01724821![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.72 |
MMs01725755![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.72 |
MMs01727513![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.72 |
MMs01727510![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.72 |
MMs01727512![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.72 |
MMs01726500![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.71 |
MMs01727061![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)C=CC2O | 0.71 |