Drugs present in MMsINC which are similar to the molecule MMscode: MMs02349130
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724973![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.73 |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.73 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01725375![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01724751![]() | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.70 |