Drugs present in MMsINC which are similar to the molecule MMscode: MMs02344779
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725013 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.80 |
MMs01725694 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.80 |
MMs01725814 | s1cccc1CN(CCN(C)C)c1ncccc1 | 0.78 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.71 |
MMs01724886 | S=C(N)c1cc(ncc1)CC | 0.71 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |