Drugs present in MMsINC which are similar to the molecule MMscode: MMs02342041
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.76 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.74 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.71 |
MMs01725455 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725866 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01725771 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.71 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.71 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.70 |