Drugs present in MMsINC which are similar to the molecule MMscode: MMs02338799
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724997![]() | S(=O)(=O)(C)c1ccc(cc1)C=1COC(=O)C=1c1ccccc1 | 0.85 |
MMs01727385![]() | S(=O)(C)c1ccc(cc1)\C=C/1\c2c(cc(F)cc2)C(CC(O)=O)=C\1C | 0.79 |
MMs01724816![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.75 |
MMs01724957![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.75 |
MMs01724995![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.70 |
MMs01727042![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.70 |