Drugs present in MMsINC which are similar to the molecule MMscode: MMs02337182
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.75 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.75 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.75 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.75 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.75 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.71 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |