Drugs present in MMsINC which are similar to the molecule MMscode: MMs02335625
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727280![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.85 |
MMs01727282![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.85 |
MMs01727284![]() | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.85 |
MMs01725106![]() | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.73 |
MMs01725107![]() | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.73 |