Drugs present in MMsINC which are similar to the molecule MMscode: MMs02328635
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.80 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.80 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725133 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01724857 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01726473 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |