Drugs present in MMsINC which are similar to the molecule MMscode: MMs02327642
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.75 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.75 |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.74 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.74 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.70 |