Drugs present in MMsINC which are similar to the molecule MMscode: MMs02326259
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725223 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.77 |
MMs01725345 | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.77 |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.74 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.74 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.71 |
MMs01726450 | S(O)(=O)(=O)c1cc(N=Nc2ccc(cc2)-c2ccc(N=Nc3cc(S(O)(=O)=O)c4c(cccc4)c3N)cc2)c(N)c2c1cccc2 | 0.70 |