Drugs present in MMsINC which are similar to the molecule MMscode: MMs02325254
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.79 |
MMs01725863 | n1cn(nc1)C(c1ccc(cc1)C#N)c1ccc(cc1)C#N | 0.74 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01725725 | o1nc(nc1NCCN(CCCC)CCCC)-c1ccccc1 | 0.72 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.71 |
MMs01724840 | n1cn(nc1)Cc1cc(cc(c1)C(C#N)(C)C)C(C#N)(C)C | 0.71 |