Drugs present in MMsINC which are similar to the molecule MMscode: MMs02323249
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.79 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.75 |
MMs01726858![]() | Ic1cc(I)c2c(nccc2)c1O | 0.74 |
MMs01727136![]() | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.71 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.71 |







