Drugs present in MMsINC which are similar to the molecule MMscode: MMs02321606
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.75 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.75 |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.74 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.74 |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.73 |
MMs01727381 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725225 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.70 |