Drugs present in MMsINC which are similar to the molecule MMscode: MMs02311397
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.93 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.79 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.79 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01725866 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725455 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725771 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |