Drugs present in MMsINC which are similar to the molecule MMscode: MMs02310406
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.78 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.77 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.77 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.77 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.74 |
MMs01725027 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.74 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |