Drugs present in MMsINC which are similar to the molecule MMscode: MMs02307259
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727442 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.76 |
MMs01724818 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.76 |
MMs01725182 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.72 |
MMs01727430 | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.72 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.72 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.72 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.72 |