Drugs present in MMsINC which are similar to the molecule MMscode: MMs02305743
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.81 |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.80 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.75 |
MMs01725008 | S1c2c(N(c3c1cccc3)CCC[NH+](C)C)cccc2 | 0.73 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.73 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.73 |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.72 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.72 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.72 |
MMs01724969 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.72 |
MMs01724823 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.72 |
MMs01725300 | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.72 |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.71 |