Drugs present in MMsINC which are similar to the molecule MMscode: MMs02304660
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.81 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.81 |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.80 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.80 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.72 |
MMs01724951 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.72 |
MMs01725015 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.72 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.72 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.71 |