Drugs present in MMsINC which are similar to the molecule MMscode: MMs02304480
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01725170 | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.74 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.71 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |
MMs01724915 | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.70 |
MMs01725342 | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.70 |