Drugs present in MMsINC which are similar to the molecule MMscode: MMs02302634
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.77 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725434 | [NH2+](CC12CCC(c3c1cccc3)c1c2cccc1)C | 0.73 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.70 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |