Drugs present in MMsINC which are similar to the molecule MMscode: MMs02298410
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.75 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.75 |
MMs01725286 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.74 |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.74 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01724837 | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.71 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |
MMs01725258 | Clc1cc(C(=O)NC2CCN(CC2)Cc2ccccc2)c(OC)cc1N | 0.71 |