Drugs present in MMsINC which are similar to the molecule MMscode: MMs02295695
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724829![]() | s1c2c(cc1C(N(O)C(=O)N)C)cccc2 | 0.79 |
MMs01725312![]() | s1c2c(cc1C(N(O)C(=O)N)C)cccc2 | 0.79 |
MMs01724937![]() | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.74 |
MMs01724922![]() | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.74 |
MMs01724819![]() | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.71 |