Drugs present in MMsINC which are similar to the molecule MMscode: MMs02293893
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726283 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC(COC(=O)C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726285 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC(COC(=O)C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726287 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC(COC(=O)C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726289 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC(COC(=O)C)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726311 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(COC)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726313 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(COC)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726315 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(COC)=C(N2C1=O)C(O)=O | 0.70 |
MMs01726317 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(COC)=C(N2C1=O)C(O)=O | 0.70 |