Drugs present in MMsINC which are similar to the molecule MMscode: MMs02288848
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726626 | [NH2+]=C(N)c1ccc(NN=Nc2ccc(cc2)C(=[NH2+])N)cc1 | 0.83 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.74 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.74 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.73 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.73 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |