Drugs present in MMsINC which are similar to the molecule MMscode: MMs02287959
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725213 | Fc1ccc(cc1)Cn1c2c(nc1NC1CCN(CC1)CCc1ccc(OC)cc1)cccc2 | 0.76 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01725048 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.70 |
MMs01727224 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.70 |