Drugs present in MMsINC which are similar to the molecule MMscode: MMs02267688
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.84 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.80 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01726473 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01725133 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01724857 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.70 |