Drugs present in MMsINC which are similar to the molecule MMscode: MMs02265689
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.79 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.79 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.77 |
MMs01727079 | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.72 |
MMs01727080 | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.72 |
MMs01727081 | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.72 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |